Products 1185301-48-7

CAS 1185301-48-7 is the registry number for N-(2-Fluorobenzyl)-n-methylglycine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(2-fluorophenyl)methyl-methylamino]acetic acid;hydrochloride (CAS 1185301-48-7) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: 2-[(2-fluorophenyl)methyl-methylamino]acetic acid;hydrochloride. InChIKey: MQQSHIQZADDLHG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClFNO2
Molecular weight233.67 g/mol
IUPAC name2-[(2-fluorophenyl)methyl-methylamino]acetic acid;hydrochloride
InChIKeyMQQSHIQZADDLHG-UHFFFAOYSA-N
SMILESCN(CC1=CC=CC=C1F)CC(=O)O.Cl

Computed by PubChem (NCBI)