CAS 1185431-26-8 is the registry number for 3-(Aminomethyl)-7-fluoro-1,2-dihydroquinolin-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 1g.
3-(aminomethyl)-7-fluoro-1H-quinolin-2-one;hydrochloride (CAS 1185431-26-8) is a chemical compound with the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. IUPAC name: 3-(aminomethyl)-7-fluoro-1H-quinolin-2-one;hydrochloride. InChIKey: LAFRJYLCZWBEIQ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 3-(aminomethyl)-7-fluoro-1H-quinolin-2-one;hydrochloride |
| InChIKey | LAFRJYLCZWBEIQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C(=C2)CN.Cl |
Computed by PubChem (NCBI)