Products 1694386-19-0
CAS 1694386-19-0 is the registry number for (2-Chloro-5-fluoropyridin-3-yl)(pyrrolidin-1-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2-chloro-5-fluoro-3-pyridinyl)-pyrrolidin-1-ylmethanone (CAS 1694386-19-0) is a chemical compound with the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. IUPAC name: (2-chloro-5-fluoro-3-pyridinyl)-pyrrolidin-1-ylmethanone. InChIKey: FMAYOCDLPNSWEN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | (2-chloro-5-fluoro-3-pyridinyl)-pyrrolidin-1-ylmethanone |
| InChIKey | FMAYOCDLPNSWEN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=C(N=CC(=C2)F)Cl |
Computed by PubChem (NCBI)