CAS 1187933-51-2 is the registry number for (2-(4-Fluorophenyl)oxazol-4-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methanamine;hydrochloride (CAS 1187933-51-2) is a chemical compound with the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. IUPAC name: [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methanamine;hydrochloride. InChIKey: SPSCBBJUGQDXCX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methanamine;hydrochloride |
| InChIKey | SPSCBBJUGQDXCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)CN)F.Cl |
Computed by PubChem (NCBI)