CAS 1327645-29-3 appears in our catalog under these names: 3-Isoxazolemethanamine, 5-(4-fluorophenyl)-, hydrochloride, 98%, ([5-(4-Fluorophenyl)isoxazol-3-yl]methyl)amine hydrochloride, 95%, (5-(4-Fluorophenyl)-1,2-oxazol-3-yl)methanamine hydrochloride, (5-(4-Fluorophenyl)isoxazol-3-yl)methanamine hydrochloride, 97%, 97%, {[5-(4-Fluorophenyl)isoxazol-3-yl]methyl}amine hydrochloride, 97%. Offered by: AmBeed, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g, 100mg, 500mg.
[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride (CAS 1327645-29-3) is a chemical compound with the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. IUPAC name: [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride. InChIKey: ZPLWNLJELZGOOC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride |
| InChIKey | ZPLWNLJELZGOOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)CN)F.Cl |
Computed by PubChem (NCBI)