CAS 1187928-55-7 is the registry number for (3-(2-Fluorophenyl)-1,2-oxazol-5-yl)methanamine Hydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 1g.
[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanamine;hydrochloride (CAS 1187928-55-7) is a chemical compound with the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. IUPAC name: [3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanamine;hydrochloride. InChIKey: ADTPJPMSCDKHGX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | [3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanamine;hydrochloride |
| InChIKey | ADTPJPMSCDKHGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)CN)F.Cl |
Computed by PubChem (NCBI)