CAS 1351595-63-5 appears in our catalog under these names: ((5-(2-Fluorophenyl)isoxazol-3-yl)methyl)amine hydrochloride, 95%, (5-(2-Fluorophenyl)-1,2-oxazol-3-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
[5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride (CAS 1351595-63-5) is a chemical compound with the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. IUPAC name: [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride. InChIKey: VPZAWSYRKGCRPX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride |
| InChIKey | VPZAWSYRKGCRPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NO2)CN)F.Cl |
Computed by PubChem (NCBI)