CAS 1696553-81-7 is the registry number for 2-Chloro-n-cyclobutyl-5-fluoropyridine-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-cyclobutyl-5-fluoropyridine-3-carboxamide (CAS 1696553-81-7) is a chemical compound with the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. IUPAC name: 2-chloro-N-cyclobutyl-5-fluoropyridine-3-carboxamide. InChIKey: PANCARNAIAQBLO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 2-chloro-N-cyclobutyl-5-fluoropyridine-3-carboxamide |
| InChIKey | PANCARNAIAQBLO-UHFFFAOYSA-N |
| SMILES | C1CC(C1)NC(=O)C2=C(N=CC(=C2)F)Cl |
Computed by PubChem (NCBI)