CAS 1185504-45-3 is the registry number for (4-(2-Aminoethoxy)phenyl)(phenyl)methanone HCl. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
[4-(2-aminoethoxy)phenyl]-phenylmethanone;hydrochloride (CAS 1185504-45-3) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: [4-(2-aminoethoxy)phenyl]-phenylmethanone;hydrochloride. InChIKey: MRIRSQOLACCREV-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | [4-(2-aminoethoxy)phenyl]-phenylmethanone;hydrochloride |
| InChIKey | MRIRSQOLACCREV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OCCN.Cl |
Computed by PubChem (NCBI)