Products 1186058-72-9
CAS 1186058-72-9 is the registry number for tert-Butyl (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate 2,2-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1S,4S)-2,2-dioxo-2lambda6-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate (CAS 1186058-72-9) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: tert-butyl (1S,4S)-2,2-dioxo-2lambda6-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate. InChIKey: VYWPUHFUKTXCIT-YUMQZZPRSA-N.
| Molecular formula | C10H17NO4S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | tert-butyl (1S,4S)-2,2-dioxo-2lambda6-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate |
| InChIKey | VYWPUHFUKTXCIT-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1CS2(=O)=O |
Computed by PubChem (NCBI)