CAS 958879-77-1 appears in our catalog under these names: Doripenem Impurity 18, (2S,4R)–1–((tert–Butoxy)carbonyl)–4–sulfanylpyrrolidine–2–carboxylic acid, (2S,4R)-1-[(tert-butoxy)carbonyl]-4-sulfanylpyrrolidine-2-carboxylic acid, 97%, 97%. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 100mg, 1g, 250mg, 500mg.
(2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-sulfanylpyrrolidine-2-carboxylic acid (CAS 958879-77-1) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-sulfanylpyrrolidine-2-carboxylic acid. InChIKey: CJGXPXFOEKLTEP-RQJHMYQMSA-N.
| Molecular formula | C10H17NO4S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-sulfanylpyrrolidine-2-carboxylic acid |
| InChIKey | CJGXPXFOEKLTEP-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)S |
Computed by PubChem (NCBI)