Products 134676-67-8

CAS 134676-67-8 appears in our catalog under these names: Thiomorpholine-2,4-dicarboxylic acid 4-tert-butyl ester, 97%, N–Boc–2–thiomorpholinecarboxylic Acid, N-BOC-thiomorpholine-2-carboxylic acid 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.

Structural formula: {0} (CAS {1})

4-[(2-methylpropan-2-yl)oxycarbonyl]thiomorpholine-2-carboxylic acid (CAS 134676-67-8) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]thiomorpholine-2-carboxylic acid. InChIKey: VJGKMSGPYQNGGK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO4S
Molecular weight247.31 g/mol
IUPAC name4-[(2-methylpropan-2-yl)oxycarbonyl]thiomorpholine-2-carboxylic acid
InChIKeyVJGKMSGPYQNGGK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCSC(C1)C(=O)O

Computed by PubChem (NCBI)