Products 2002427-60-1
CAS 2002427-60-1 is the registry number for Cysteine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-acetamido-3-(2-hydroxy-3-methylbut-3-enyl)sulfanylpropanoic acid (CAS 2002427-60-1) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: (2R)-2-acetamido-3-(2-hydroxy-3-methylbut-3-enyl)sulfanylpropanoic acid. InChIKey: JHTHVPMLUUPGSD-IENPIDJESA-N.
| Molecular formula | C10H17NO4S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(2-hydroxy-3-methylbut-3-enyl)sulfanylpropanoic acid |
| InChIKey | JHTHVPMLUUPGSD-IENPIDJESA-N |
| SMILES | CC(=C)C(CSC[C@@H](C(=O)O)NC(=O)C)O |
Computed by PubChem (NCBI)