Products 160436-61-3

CAS 160436-61-3 is the registry number for 3-tert-butyl 4-methyl (4R)-1,3-thiazolidine-3,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-O-tert-butyl 4-O-methyl (4R)-1,3-thiazolidine-3,4-dicarboxylate (CAS 160436-61-3) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl (4R)-1,3-thiazolidine-3,4-dicarboxylate. InChIKey: LKAZETDWVWEZSD-ZETCQYMHSA-N.

Identity
Molecular formulaC10H17NO4S
Molecular weight247.31 g/mol
IUPAC name3-O-tert-butyl 4-O-methyl (4R)-1,3-thiazolidine-3,4-dicarboxylate
InChIKeyLKAZETDWVWEZSD-ZETCQYMHSA-N
SMILESCC(C)(C)OC(=O)N1CSC[C@H]1C(=O)OC

Computed by PubChem (NCBI)