CAS 1223573-25-8 appears in our catalog under these names: 1,1-Dioxo-1-thia-6-azaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester, 95%, tert–Butyl 1–thia–6–azaspiro(3·3)heptane–6–carboxylate 1，1–dioxide, 1,1-Dioxo-1-thia-6-azaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester, 98%, 98%, 1,1-DIOXO-1-THIA-6-AZASPIRO[3.3]HEPTANE-6-CARBOXYLIC ACID TERT-BUTYL ESTER, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 500mg, 1g.
Tert-butyl 1,1-dioxo-1lambda6-thia-6-azaspiro[3.3]heptane-6-carboxylate (CAS 1223573-25-8) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: tert-butyl 1,1-dioxo-1lambda6-thia-6-azaspiro[3.3]heptane-6-carboxylate. InChIKey: UPDSKGRMNPTITH-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | tert-butyl 1,1-dioxo-1lambda6-thia-6-azaspiro[3.3]heptane-6-carboxylate |
| InChIKey | UPDSKGRMNPTITH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCS2(=O)=O |
Computed by PubChem (NCBI)