CAS 1186614-21-0 is the registry number for 3-Methoxy-5-nitro-1h-pyrazolo[3,4-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-methoxy-5-nitro-1H-pyrazolo[5,4-b]pyridine (CAS 1186614-21-0) is a chemical compound with the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. IUPAC name: 3-methoxy-5-nitro-1H-pyrazolo[5,4-b]pyridine. InChIKey: QKCRVRSYXLBOET-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O3 |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | 3-methoxy-5-nitro-1H-pyrazolo[5,4-b]pyridine |
| InChIKey | QKCRVRSYXLBOET-UHFFFAOYSA-N |
| SMILES | COC1=NNC2=C1C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)