CAS 1443978-99-1 is the registry number for 6-Methyl-4-oxo-4,5-dihydro[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-methyl-4-oxo-5H-triazolo[1,5-a]pyrazine-3-carboxylic acid (CAS 1443978-99-1) is a chemical compound with the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. IUPAC name: 6-methyl-4-oxo-5H-triazolo[1,5-a]pyrazine-3-carboxylic acid. InChIKey: PDMSZJSZLNINLN-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O3 |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | 6-methyl-4-oxo-5H-triazolo[1,5-a]pyrazine-3-carboxylic acid |
| InChIKey | PDMSZJSZLNINLN-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(N=N2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)