CAS 1780674-28-3 is the registry number for Methyl 5-oxo-4,5-dihydro-[1,2,3]triazolo[1,5-a]pyrimidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-oxo-1H-triazolo[1,5-a]pyrimidine-3-carboxylate (CAS 1780674-28-3) is a chemical compound with the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. IUPAC name: methyl 5-oxo-1H-triazolo[1,5-a]pyrimidine-3-carboxylate. InChIKey: IKDWMYJKOFUUGV-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O3 |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | methyl 5-oxo-1H-triazolo[1,5-a]pyrimidine-3-carboxylate |
| InChIKey | IKDWMYJKOFUUGV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNN2C1=NC(=O)C=C2 |
Computed by PubChem (NCBI)