Products 842972-47-8

CAS 842972-47-8 is the registry number for ([1,2,4]Triazolo[4,3-b]pyridazin-6-yloxy)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)acetic acid (CAS 842972-47-8) is a chemical compound with the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. IUPAC name: 2-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)acetic acid. InChIKey: KCCUGNPBQXGXGB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N4O3
Molecular weight194.15 g/mol
IUPAC name2-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)acetic acid
InChIKeyKCCUGNPBQXGXGB-UHFFFAOYSA-N
SMILESC1=CC(=NN2C1=NN=C2)OCC(=O)O

Computed by PubChem (NCBI)