CAS 6298-53-9 appears in our catalog under these names: 1,6-Dihydro-6-oxo-9h-purine-9-acetic acid, 95%, 2–(6–Oxo–1,6–dihydro–9H–purin–9–yl)acetic acid, 9H-Purine-9-acetic acid, 1,6-dihydro-6-oxo-, 95%, 95%, 2-(6-oxo-6,9-dihydro-3H-purin-9-yl)acetic acid, 98%, 2-(6-Oxo-1,6-dihydro-9H-purin-9-yl)acetic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-(6-oxo-1H-purin-9-yl)acetic acid (CAS 6298-53-9) is a chemical compound with the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. IUPAC name: 2-(6-oxo-1H-purin-9-yl)acetic acid. InChIKey: UAPMVQVCHTYAII-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O3 |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | 2-(6-oxo-1H-purin-9-yl)acetic acid |
| InChIKey | UAPMVQVCHTYAII-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2CC(=O)O |
Computed by PubChem (NCBI)