CAS 18378-29-5 appears in our catalog under these names: N-methyl-7-nitro-2,1,3-benzoxadiazol-4-amine, >95% (HPLC), N-Methyl-7-nitro-2,1,3-benzoxadiazol-4-amine, 95%, N-Methyl-7-nitro-2,1,3-benzoxadiazol-4-amine. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 10mg, 50mg, 5mg, 1g, 0,5g.
N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine (CAS 18378-29-5) is a chemical compound with the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. IUPAC name: N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine. InChIKey: UAPBYPSUWZVMRV-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O3 |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| InChIKey | UAPBYPSUWZVMRV-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C2=NON=C12)[N+](=O)[O-] |
Computed by PubChem (NCBI)