CAS 2155875-34-4 is the registry number for 5-Methoxy-8-nitro-[1,2,4]triazolo[1,5-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-8-nitro-[1,2,4]triazolo[1,5-a]pyridine (CAS 2155875-34-4) is a chemical compound with the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. IUPAC name: 5-methoxy-8-nitro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: GYEZWERGNZPMNZ-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O3 |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | 5-methoxy-8-nitro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | GYEZWERGNZPMNZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=NC=NN12)[N+](=O)[O-] |
Computed by PubChem (NCBI)