CAS 1186662-39-4 is the registry number for (3S)-1-([3-(Aminomethyl)-1,2,4-oxadiazol-5-yl]carbonyl)pyrrolidin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone (CAS 1186662-39-4) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: [3-(aminomethyl)-1,2,4-oxadiazol-5-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone. InChIKey: WYRDQLSPXCATMA-YFKPBYRVSA-N.
| Molecular formula | C8H12N4O3 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | [3-(aminomethyl)-1,2,4-oxadiazol-5-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
| InChIKey | WYRDQLSPXCATMA-YFKPBYRVSA-N |
| SMILES | C1CN(C[C@H]1O)C(=O)C2=NC(=NO2)CN |
Computed by PubChem (NCBI)