CAS 89073-60-9 appears in our catalog under these names: 6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1h,3h)-dione, 95%, 1,3-Diethyl-5-nitroso-6-aminouracil, 1,3–Diethyl–5–nitroso–6–aminouracil. Offered by: Combi-blocks, TRC, GLPBio. Available pack sizes: 100mg, 1g, 250mg, 500mg, 50mg.
6-amino-1,3-diethyl-5-nitrosopyrimidine-2,4-dione (CAS 89073-60-9) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: 6-amino-1,3-diethyl-5-nitrosopyrimidine-2,4-dione. InChIKey: GAZDRRFBKXZFCM-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O3 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 6-amino-1,3-diethyl-5-nitrosopyrimidine-2,4-dione |
| InChIKey | GAZDRRFBKXZFCM-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=O)N(C1=O)CC)N=O)N |
Computed by PubChem (NCBI)