Products 1597448-45-7

CAS 1597448-45-7 is the registry number for Caffeine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl-[3-methyl-5-(methylamino)imidazole-4-carbonyl]carbamic acid (CAS 1597448-45-7) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: methyl-[3-methyl-5-(methylamino)imidazole-4-carbonyl]carbamic acid. InChIKey: NBKUZIYGZSJSKO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N4O3
Molecular weight212.21 g/mol
IUPAC namemethyl-[3-methyl-5-(methylamino)imidazole-4-carbonyl]carbamic acid
InChIKeyNBKUZIYGZSJSKO-UHFFFAOYSA-N
SMILESCNC1=C(N(C=N1)C)C(=O)N(C)C(=O)O

Computed by PubChem (NCBI)