CAS 1374829-43-2 appears in our catalog under these names: 2–Methyl–2–(3–methyl–4–nitro–1H–pyrazol–1–yl)propanamide, 2-Methyl-2-(3-methyl-4-nitro-1h-pyrazol-1-yl)propanamide, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-methyl-2-(3-methyl-4-nitropyrazol-1-yl)propanamide (CAS 1374829-43-2) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: 2-methyl-2-(3-methyl-4-nitropyrazol-1-yl)propanamide. InChIKey: WJDDVKQDZUPKRU-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O3 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 2-methyl-2-(3-methyl-4-nitropyrazol-1-yl)propanamide |
| InChIKey | WJDDVKQDZUPKRU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1[N+](=O)[O-])C(C)(C)C(=O)N |
Computed by PubChem (NCBI)