CAS 33130-55-1 appears in our catalog under these names: Caffeine Impurity 8, 6-Amino-5-(N-formyl-N-methylamino)-1,3-dimethyluracil. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
N-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-N-methylformamide (CAS 33130-55-1) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: N-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-N-methylformamide. InChIKey: DSJVDNYAPZJQQX-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O3 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | N-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-N-methylformamide |
| InChIKey | DSJVDNYAPZJQQX-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)N(C)C=O)N |
Computed by PubChem (NCBI)