CAS 54536-15-1 appears in our catalog under these names: Caffeine Impurity 9, Caffeidine Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 500mg.
3-methyl-5-[methyl(methylcarbamoyl)amino]imidazole-4-carboxylic acid (CAS 54536-15-1) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: 3-methyl-5-[methyl(methylcarbamoyl)amino]imidazole-4-carboxylic acid. InChIKey: KCDXKHFRZVPYRR-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O3 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 3-methyl-5-[methyl(methylcarbamoyl)amino]imidazole-4-carboxylic acid |
| InChIKey | KCDXKHFRZVPYRR-UHFFFAOYSA-N |
| SMILES | CNC(=O)N(C)C1=C(N(C=N1)C)C(=O)O |
Computed by PubChem (NCBI)