Products 43194-95-2
CAS 43194-95-2 appears in our catalog under these names: Cefazolin Impurity 41, Ceftezole Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(tetrazol-1-yl)acetyl] 2,2-dimethylpropanoate (CAS 43194-95-2) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: [2-(tetrazol-1-yl)acetyl] 2,2-dimethylpropanoate. InChIKey: HDMIZBWHJQAJOO-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O3 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | [2-(tetrazol-1-yl)acetyl] 2,2-dimethylpropanoate |
| InChIKey | HDMIZBWHJQAJOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC(=O)CN1C=NN=N1 |
Computed by PubChem (NCBI)