Products 1187928-10-4
CAS 1187928-10-4 appears in our catalog under these names: 5-Methoxycarbonyl-2,3-dihydro-1h-indole hydrochloride, 97%, 5-Methoxycarbonyl-2,3-dihydro-1H-indole hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
Methyl 2,3-dihydro-1H-indole-5-carboxylate;hydrochloride (CAS 1187928-10-4) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-5-carboxylate;hydrochloride. InChIKey: SUEQCDVQNSWAGG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-5-carboxylate;hydrochloride |
| InChIKey | SUEQCDVQNSWAGG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NCC2.Cl |
Computed by PubChem (NCBI)