Products 1187928-23-9

CAS 1187928-23-9 is the registry number for Methyl indoline-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2,3-dihydro-1H-indole-3-carboxylate;hydrochloride (CAS 1187928-23-9) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-3-carboxylate;hydrochloride. InChIKey: XFCKOZFVPUTOHP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO2
Molecular weight213.66 g/mol
IUPAC namemethyl 2,3-dihydro-1H-indole-3-carboxylate;hydrochloride
InChIKeyXFCKOZFVPUTOHP-UHFFFAOYSA-N
SMILESCOC(=O)C1CNC2=CC=CC=C12.Cl

Computed by PubChem (NCBI)