Products 1187930-01-3

CAS 1187930-01-3 is the registry number for 3-Methylaminomethyl-benzoic acid methyl ester hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-(methylaminomethyl)benzoate;hydrochloride (CAS 1187930-01-3) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-(methylaminomethyl)benzoate;hydrochloride. InChIKey: WUBDXFGVYQGRQF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO2
Molecular weight215.67 g/mol
IUPAC namemethyl 3-(methylaminomethyl)benzoate;hydrochloride
InChIKeyWUBDXFGVYQGRQF-UHFFFAOYSA-N
SMILESCNCC1=CC(=CC=C1)C(=O)OC.Cl

Computed by PubChem (NCBI)