CAS 1187930-07-9 appears in our catalog under these names: 4-Amino-1-(pyridin-3-yl)butan-1-one dihydrochloride, 95%, 4-Amino-1-(pyridin-3-yl)butan-1-one dihydrochloride, 95+%, 4–Amino–1–(pyridin–3–yl)butan–1–one dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-amino-1-pyridin-3-ylbutan-1-one;dihydrochloride (CAS 1187930-07-9) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: 4-amino-1-pyridin-3-ylbutan-1-one;dihydrochloride. InChIKey: NIGIIOXUSYLDIQ-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 4-amino-1-pyridin-3-ylbutan-1-one;dihydrochloride |
| InChIKey | NIGIIOXUSYLDIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)CCCN.Cl.Cl |
Computed by PubChem (NCBI)