CAS 2940872-22-8 appears in our catalog under these names: trans-5-(2-pyridyl)pyrrolidin-3-ol,dihydrochloride, 95%, trans-5-(2-pyridyl)pyrrolidin-3-ol,dihydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
(3S,5R)-5-pyridin-2-ylpyrrolidin-3-ol;dihydrochloride (CAS 2940872-22-8) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: (3S,5R)-5-pyridin-2-ylpyrrolidin-3-ol;dihydrochloride. InChIKey: HIFKCCOLNPPVRS-CJGWJYNLSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | (3S,5R)-5-pyridin-2-ylpyrrolidin-3-ol;dihydrochloride |
| InChIKey | HIFKCCOLNPPVRS-CJGWJYNLSA-N |
| SMILES | C1[C@@H](CN[C@H]1C2=CC=CC=N2)O.Cl.Cl |
Computed by PubChem (NCBI)