CAS 2940870-73-3 is the registry number for cis-5-(2-pyridyl)pyrrolidin-3-ol dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5R)-5-pyridin-2-ylpyrrolidin-3-ol;dihydrochloride (CAS 2940870-73-3) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: (3R,5R)-5-pyridin-2-ylpyrrolidin-3-ol;dihydrochloride. InChIKey: HIFKCCOLNPPVRS-QRUOIXDJSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | (3R,5R)-5-pyridin-2-ylpyrrolidin-3-ol;dihydrochloride |
| InChIKey | HIFKCCOLNPPVRS-QRUOIXDJSA-N |
| SMILES | C1[C@H](CN[C@H]1C2=CC=CC=N2)O.Cl.Cl |
Computed by PubChem (NCBI)