Products 1197761-21-9
CAS 1197761-21-9 is the registry number for 3-Amino-3-phenylpropanamide dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-amino-3-phenylpropanamide;dihydrochloride (CAS 1197761-21-9) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: 3-amino-3-phenylpropanamide;dihydrochloride. InChIKey: VVDXIOUIZRLVSA-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 3-amino-3-phenylpropanamide;dihydrochloride |
| InChIKey | VVDXIOUIZRLVSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)N)N.Cl.Cl |
Computed by PubChem (NCBI)