CAS 1803607-37-5 appears in our catalog under these names: 4-Methyl-3,4-dihydro-2h-1,4-benzoxazin-7-amine dihydrochloride, 95%, 4-Methyl-3,4-dihydro-2H-1,4-benzoxazin-7-amine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-methyl-2,3-dihydro-1,4-benzoxazin-7-amine;dihydrochloride (CAS 1803607-37-5) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: 4-methyl-2,3-dihydro-1,4-benzoxazin-7-amine;dihydrochloride. InChIKey: WMOSCGVLAJJQMN-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 4-methyl-2,3-dihydro-1,4-benzoxazin-7-amine;dihydrochloride |
| InChIKey | WMOSCGVLAJJQMN-UHFFFAOYSA-N |
| SMILES | CN1CCOC2=C1C=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)