Products 36681-58-0
CAS 36681-58-0 appears in our catalog under these names: Kynuramine 2HCl, 95%, Kynuramine dihydrochloride, Kynuramine dihydrochloride, 3-Amino-1-(2-aminophenyl)propan-1-one dihydrochloride, 99%, 99%, Kynuramine dihydrochloride, min. 95 %, 5 mg. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 1g, 1mg, 10mg, 5mg, 25mg, 100mg, 50mg, 10 mg.
3-amino-1-(2-aminophenyl)propan-1-one;dihydrochloride (CAS 36681-58-0) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: 3-amino-1-(2-aminophenyl)propan-1-one;dihydrochloride. InChIKey: GIUIHRRGPBPUAO-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 3-amino-1-(2-aminophenyl)propan-1-one;dihydrochloride |
| InChIKey | GIUIHRRGPBPUAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CCN)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-amino-1-(2-aminophenyl)propan-1-one dihydrochloride, Kynuramine dihydrochloride, Kynuramine (dihydrochloride), 3-amino-1-(2-aminophenyl)propan-1-one;dihydrochloride, Kynuramine 2HCl, 3-Amino-1-(2-aminophenyl)-1-propanone dihydrochloride, 3-amino-1-(2-aminophenyl)propan-1-onedihydrochloride