CAS 90533-86-1 appears in our catalog under these names: 2-(Pyridin-3-yl)morpholine dihydrochloride, 97%, 2-(Pyridin-3-yl)morpholine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 5g, 100mg.
2-pyridin-3-ylmorpholine;dihydrochloride (CAS 90533-86-1) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: 2-pyridin-3-ylmorpholine;dihydrochloride. InChIKey: DEXSISUJWGOIHG-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 2-pyridin-3-ylmorpholine;dihydrochloride |
| InChIKey | DEXSISUJWGOIHG-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)