CAS 1187931-06-1 is the registry number for 2-Amino-1-(3,5-difluorophenyl)-ethanone HCl. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-amino-1-(3,5-difluorophenyl)ethanone;hydrochloride (CAS 1187931-06-1) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 2-amino-1-(3,5-difluorophenyl)ethanone;hydrochloride. InChIKey: CNDKKHFIJCGZIL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 2-amino-1-(3,5-difluorophenyl)ethanone;hydrochloride |
| InChIKey | CNDKKHFIJCGZIL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)CN.Cl |
Computed by PubChem (NCBI)