CAS 1187932-76-8 appears in our catalog under these names: [(2-Benzyl-1,3-thiazol-4-yl)methyl]amine dihydrochloride, 95%, ((2-Benzyl-1,3-thiazol-4-yl)methyl)amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
(2-benzyl-1,3-thiazol-4-yl)methanamine;dihydrochloride (CAS 1187932-76-8) is a chemical compound with the molecular formula C11H14Cl2N2S and a molecular weight of 277.2 g/mol. IUPAC name: (2-benzyl-1,3-thiazol-4-yl)methanamine;dihydrochloride. InChIKey: PLWCRYKXGKCNKF-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2S |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | (2-benzyl-1,3-thiazol-4-yl)methanamine;dihydrochloride |
| InChIKey | PLWCRYKXGKCNKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CS2)CN.Cl.Cl |
Computed by PubChem (NCBI)