CAS 2095409-47-3 is the registry number for (4-methyl-2-phenyl-1,3-thiazol-5-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(4-methyl-2-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride (CAS 2095409-47-3) is a chemical compound with the molecular formula C11H14Cl2N2S and a molecular weight of 277.2 g/mol. IUPAC name: (4-methyl-2-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride. InChIKey: PEUROHCWJNNSKS-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2S |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | (4-methyl-2-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride |
| InChIKey | PEUROHCWJNNSKS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)