CAS 921101-72-6 is the registry number for ([2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl)amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[2-(4-methylphenyl)-1,3-thiazol-5-yl]methanamine;dihydrochloride (CAS 921101-72-6) is a chemical compound with the molecular formula C11H14Cl2N2S and a molecular weight of 277.2 g/mol. IUPAC name: [2-(4-methylphenyl)-1,3-thiazol-5-yl]methanamine;dihydrochloride. InChIKey: WRMQSCRDSDBBFJ-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2S |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | [2-(4-methylphenyl)-1,3-thiazol-5-yl]methanamine;dihydrochloride |
| InChIKey | WRMQSCRDSDBBFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC=C(S2)CN.Cl.Cl |
Computed by PubChem (NCBI)