CAS 1269288-94-9 is the registry number for N-Methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 5g.
N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride (CAS 1269288-94-9) is a chemical compound with the molecular formula C11H14Cl2N2S and a molecular weight of 277.2 g/mol. IUPAC name: N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride. InChIKey: RYIBGXVVFRKUPL-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2S |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride |
| InChIKey | RYIBGXVVFRKUPL-UHFFFAOYSA-N |
| SMILES | CNCC1=CSC(=N1)C2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)