CAS 2031258-48-5 is the registry number for (3-(2-Methyl-1,3-thiazol-4-yl)phenyl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine;dihydrochloride (CAS 2031258-48-5) is a chemical compound with the molecular formula C11H14Cl2N2S and a molecular weight of 277.2 g/mol. IUPAC name: [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine;dihydrochloride. InChIKey: VYNMKLFMYRIPTB-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2S |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | [3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine;dihydrochloride |
| InChIKey | VYNMKLFMYRIPTB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=CC(=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)