CAS 1332529-21-1 is the registry number for N-Methyl-1-(4-phenylthiazol-5-yl)methanamine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
N-methyl-1-(4-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride (CAS 1332529-21-1) is a chemical compound with the molecular formula C11H14Cl2N2S and a molecular weight of 277.2 g/mol. IUPAC name: N-methyl-1-(4-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride. InChIKey: BAVNCMFZJUNQTG-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2S |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | N-methyl-1-(4-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride |
| InChIKey | BAVNCMFZJUNQTG-UHFFFAOYSA-N |
| SMILES | CNCC1=C(N=CS1)C2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)