CAS 2248268-06-4 is the registry number for (4-Methyl-1,3-thiazol-2-yl)(phenyl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-methyl-1,3-thiazol-2-yl)-phenylmethanamine;dihydrochloride (CAS 2248268-06-4) is a chemical compound with the molecular formula C11H14Cl2N2S and a molecular weight of 277.2 g/mol. IUPAC name: (4-methyl-1,3-thiazol-2-yl)-phenylmethanamine;dihydrochloride. InChIKey: XUSGNYPVOKZSHB-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2S |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | (4-methyl-1,3-thiazol-2-yl)-phenylmethanamine;dihydrochloride |
| InChIKey | XUSGNYPVOKZSHB-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C(C2=CC=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)