Products 1188029-07-3

CAS 1188029-07-3 is the registry number for 4-(Furan-2-yl)-1H-pyrrole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(furan-2-yl)-1H-pyrrole-3-carboxylic acid (CAS 1188029-07-3) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 4-(furan-2-yl)-1H-pyrrole-3-carboxylic acid. InChIKey: APFSDBYQIKDVJM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO3
Molecular weight177.16 g/mol
IUPAC name4-(furan-2-yl)-1H-pyrrole-3-carboxylic acid
InChIKeyAPFSDBYQIKDVJM-UHFFFAOYSA-N
SMILESC1=COC(=C1)C2=CNC=C2C(=O)O

Computed by PubChem (NCBI)