CAS 1188228-50-3 is the registry number for Ethyl 5-(2,3-dichlorophenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(2,3-dichlorophenyl)-1,2-oxazole-3-carboxylate (CAS 1188228-50-3) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: ethyl 5-(2,3-dichlorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: UFCCEIPTFXJWRX-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | ethyl 5-(2,3-dichlorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | UFCCEIPTFXJWRX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)