CAS 254749-13-8 is the registry number for Ethyl 5-(2,4-dichlorophenyl)oxazole-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
Ethyl 5-(2,4-dichlorophenyl)-1,3-oxazole-4-carboxylate (CAS 254749-13-8) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: ethyl 5-(2,4-dichlorophenyl)-1,3-oxazole-4-carboxylate. InChIKey: ZQOOJNKPAQTMIR-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | ethyl 5-(2,4-dichlorophenyl)-1,3-oxazole-4-carboxylate |
| InChIKey | ZQOOJNKPAQTMIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC=N1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)